C16H14FN3O4S — CID 8514954
2-fluoro-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]benzohydrazide (PubChem CID 8514954) has the molecular formula C16H14FN3O4S and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-fluoro-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 8514954 |
| Molecular Formula | C16H14FN3O4S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-fluoro-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]benzohydrazide |
| SMILES | O=C1CCc2cc(S(=O)(=O)NNC(=O)c3ccccc3F)ccc2N1 |
| InChI | InChI=1S/C16H14FN3O4S/c17-13-4-2-1-3-12(13)16(22)19-20-25(23,24)11-6-7-14-10(9-11)5-8-15(21)18-14/h1-4,6-7,9,20H,5,8H2,(H,18,21)(H,19,22) |
| InChIKey | GMGDKNHHHQJIMG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|