C27H21Cl2NO5S — CID 53473572
3-(3,4-dichlorophenyl)-N-[4-(4-ethoxyphenoxy)phenyl]sulfonylbenzamide (PubChem CID 53473572) has the molecular formula C27H21Cl2NO5S and a molecular weight of 542.44 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[4-(4-ethoxyphenoxy)phenyl]sulfonylbenzamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[4-(4-ethoxyphenoxy)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 53473572 |
| Molecular Formula | C27H21Cl2NO5S |
| Molecular Weight | 542.44 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[4-(4-ethoxyphenoxy)phenyl]sulfonylbenzamide |
| SMILES | CCOc1ccc(Oc2ccc(S(=O)(=O)NC(=O)c3cccc(-c4ccc(Cl)c(Cl)c4)c3)cc2)cc1 |
| InChI | InChI=1S/C27H21Cl2NO5S/c1-2-34-21-7-9-22(10-8-21)35-23-11-13-24(14-12-23)36(32,33)30-27(31)20-5-3-4-18(16-20)19-6-15-25(28)26(29)17-19/h3-17H,2H2,1H3,(H,30,31) |
| InChIKey | NTOKZWCGGSZEAX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |