C13H12Cl2N2O4S — CID 78884546
4,5-dichloro-N-(4-ethoxyphenyl)sulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 78884546) has the molecular formula C13H12Cl2N2O4S and a molecular weight of 363.22 g/mol. Its IUPAC name is 4,5-dichloro-N-(4-ethoxyphenyl)sulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(4-ethoxyphenyl)sulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78884546 |
| Molecular Formula | C13H12Cl2N2O4S |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 4,5-dichloro-N-(4-ethoxyphenyl)sulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(=O)c2cc(Cl)c(Cl)[nH]2)cc1 |
| InChI | InChI=1S/C13H12Cl2N2O4S/c1-2-21-8-3-5-9(6-4-8)22(19,20)17-13(18)11-7-10(14)12(15)16-11/h3-7,16H,2H2,1H3,(H,17,18) |
| InChIKey | UVMBYKRACYYXPP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |