C16H11Cl2NO2 — CID 87204536
4-(2,3-dichlorophenoxy)-1-methylindole-3-carbaldehyde (PubChem CID 87204536) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-1-methylindole-3-carbaldehyde.
| Compound Name | 4-(2,3-dichlorophenoxy)-1-methylindole-3-carbaldehyde |
|---|---|
| PubChem CID | 87204536 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-1-methylindole-3-carbaldehyde |
| SMILES | Cn1cc(C=O)c2c(Oc3cccc(Cl)c3Cl)cccc21 |
| InChI | InChI=1S/C16H11Cl2NO2/c1-19-8-10(9-20)15-12(19)5-3-6-13(15)21-14-7-2-4-11(17)16(14)18/h2-9H,1H3 |
| InChIKey | VWSSDBJNKYRJOB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|