C16H16N4O3S — CID 97377835
(Z)-3-(1-methylindol-3-yl)-N-(1-methylpyrazol-4-yl)sulfonylprop-2-enamide (PubChem CID 97377835) has the molecular formula C16H16N4O3S and a molecular weight of 344.40 g/mol. Its IUPAC name is (Z)-3-(1-methylindol-3-yl)-N-(1-methylpyrazol-4-yl)sulfonylprop-2-enamide.
| Compound Name | (Z)-3-(1-methylindol-3-yl)-N-(1-methylpyrazol-4-yl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 97377835 |
| Molecular Formula | C16H16N4O3S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (Z)-3-(1-methylindol-3-yl)-N-(1-methylpyrazol-4-yl)sulfonylprop-2-enamide |
| SMILES | Cn1cc(S(=O)(=O)NC(=O)/C=C\c2cn(C)c3ccccc23)cn1 |
| InChI | InChI=1S/C16H16N4O3S/c1-19-10-12(14-5-3-4-6-15(14)19)7-8-16(21)18-24(22,23)13-9-17-20(2)11-13/h3-11H,1-2H3,(H,18,21)/b8-7- |
| InChIKey | IFJHGUKQNKNGAF-FPLPWBNLSA-N |
| XLogP | 1.43 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|