C13H14N4O5S — CID 56801259
methyl N-[3-[(1-methylpyrazol-4-yl)sulfonylcarbamoyl]phenyl]carbamate (PubChem CID 56801259) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is methyl N-[3-[(1-methylpyrazol-4-yl)sulfonylcarbamoyl]phenyl]carbamate.
| Compound Name | methyl N-[3-[(1-methylpyrazol-4-yl)sulfonylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 56801259 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | methyl N-[3-[(1-methylpyrazol-4-yl)sulfonylcarbamoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(C(=O)NS(=O)(=O)c2cnn(C)c2)c1 |
| InChI | InChI=1S/C13H14N4O5S/c1-17-8-11(7-14-17)23(20,21)16-12(18)9-4-3-5-10(6-9)15-13(19)22-2/h3-8H,1-2H3,(H,15,19)(H,16,18) |
| InChIKey | OFVDOPPCVCSJCL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |