C18H24N2O3 — CID 110002949
(E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-(1-methylindol-3-yl)prop-2-enamide (PubChem CID 110002949) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-(1-methylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-(1-methylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 110002949 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (E)-N-(4-hydroxy-1-methoxy-2-methylbutan-2-yl)-3-(1-methylindol-3-yl)prop-2-enamide |
| SMILES | COCC(C)(CCO)NC(=O)/C=C/c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C18H24N2O3/c1-18(10-11-21,13-23-3)19-17(22)9-8-14-12-20(2)16-7-5-4-6-15(14)16/h4-9,12,21H,10-11,13H2,1-3H3,(H,19,22)/b9-8+ |
| InChIKey | XLZBFDUCFDRUHC-CMDGGOBGSA-N |
| XLogP | 2.10 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|