C24H17ClF2N2O4S — CID 46885504
(E)-N-(3-chlorophenyl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3H-indol-7-yl]prop-2-enamide (PubChem CID 46885504) has the molecular formula C24H17ClF2N2O4S and a molecular weight of 502.93 g/mol. Its IUPAC name is (E)-N-(3-chlorophenyl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3H-indol-7-yl]prop-2-enamide.
| Compound Name | (E)-N-(3-chlorophenyl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3H-indol-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 46885504 |
| Molecular Formula | C24H17ClF2N2O4S |
| Molecular Weight | 502.93 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | (E)-N-(3-chlorophenyl)sulfonyl-3-[1-[(3,4-difluorophenyl)methyl]-2-oxo-3H-indol-7-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc(F)c(F)c1)C(=O)C2)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H17ClF2N2O4S/c25-18-5-2-6-19(13-18)34(32,33)28-22(30)10-8-16-3-1-4-17-12-23(31)29(24(16)17)14-15-7-9-20(26)21(27)11-15/h1-11,13H,12,14H2,(H,28,30)/b10-8+ |
| InChIKey | HLGCQPYCPQIDGE-CSKARUKUSA-N |
| XLogP | 4.23 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|