C18H19NO4 — CID 39150590
(E)-3-[1-[(4-propoxycarbonylphenyl)methyl]pyrrol-2-yl]prop-2-enoic acid (PubChem CID 39150590) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is (E)-3-[1-[(4-propoxycarbonylphenyl)methyl]pyrrol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-[(4-propoxycarbonylphenyl)methyl]pyrrol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39150590 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (E)-3-[1-[(4-propoxycarbonylphenyl)methyl]pyrrol-2-yl]prop-2-enoic acid |
| SMILES | CCCOC(=O)c1ccc(Cn2cccc2/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-2-12-23-18(22)15-7-5-14(6-8-15)13-19-11-3-4-16(19)9-10-17(20)21/h3-11H,2,12-13H2,1H3,(H,20,21)/b10-9+ |
| InChIKey | BGEYKPLIJFIMEX-MDZDMXLPSA-N |
| XLogP | 3.20 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|