C17H13F2NO4 — CID 72711164
(2Z,5E)-6-[1-[(2,5-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid (PubChem CID 72711164) has the molecular formula C17H13F2NO4 and a molecular weight of 333.29 g/mol. Its IUPAC name is (2Z,5E)-6-[1-[(2,5-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid.
| Compound Name | (2Z,5E)-6-[1-[(2,5-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 72711164 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (2Z,5E)-6-[1-[(2,5-difluorophenyl)methyl]pyrrol-2-yl]-2-hydroxy-4-oxohexa-2,5-dienoic acid |
| SMILES | O=C(/C=C(\O)C(=O)O)/C=C/c1cccn1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H13F2NO4/c18-12-3-6-15(19)11(8-12)10-20-7-1-2-13(20)4-5-14(21)9-16(22)17(23)24/h1-9,22H,10H2,(H,23,24)/b5-4+,16-9- |
| InChIKey | IQGYVNMVXCTPBK-VFBGFVPRSA-N |
| XLogP | 2.92 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|