About 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one
3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one (PubChem CID 115659281) has the molecular formula C10H7F2NOS
and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one |
| PubChem CID | 115659281 |
| Molecular Formula | C10H7F2NOS |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one |
| SMILES | O=c1sccn1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C10H7F2NOS/c11-8-1-2-9(12)7(5-8)6-13-3-4-15-10(13)14/h1-5H,6H2 |
| InChIKey | YUPBFCDZDOTGHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one?
The IUPAC name of 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one (CID 115659281) is 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one.
What is the SMILES notation for 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one?
The canonical SMILES for 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one is O=c1sccn1Cc1cc(F)ccc1F.
What is the InChIKey of 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one?
The InChIKey is YUPBFCDZDOTGHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F2NOS/c11-8-1-2-9(12)7(5-8)6-13-3-4-15-10(13)14/h1-5H,6H2.
What are the key properties of 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one?
3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one has a molecular weight of 227.24 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one is sourced from PubChem (CID 115659281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).