C10H7F2NOS — CID 115659281
3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one (PubChem CID 115659281) has the molecular formula C10H7F2NOS and a molecular weight of 227.24 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 115659281 |
| Molecular Formula | C10H7F2NOS |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methyl]-1,3-thiazol-2-one |
| SMILES | O=c1sccn1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C10H7F2NOS/c11-8-1-2-9(12)7(5-8)6-13-3-4-15-10(13)14/h1-5H,6H2 |
| InChIKey | YUPBFCDZDOTGHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |