C11H9FN2OS2 — CID 64765617
4-fluoro-2-[(2-oxo-1,3-thiazol-3-yl)methyl]benzenecarbothioamide (PubChem CID 64765617) has the molecular formula C11H9FN2OS2 and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-fluoro-2-[(2-oxo-1,3-thiazol-3-yl)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-2-[(2-oxo-1,3-thiazol-3-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64765617 |
| Molecular Formula | C11H9FN2OS2 |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 4-fluoro-2-[(2-oxo-1,3-thiazol-3-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(F)cc1Cn1ccsc1=O |
| InChI | InChI=1S/C11H9FN2OS2/c12-8-1-2-9(10(13)16)7(5-8)6-14-3-4-17-11(14)15/h1-5H,6H2,(H2,13,16) |
| InChIKey | XMTWJIUJENNTNY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|