C13H12FN3OS — CID 64765062
4-fluoro-2-[(3-methyl-6-oxopyridazin-1-yl)methyl]benzenecarbothioamide (PubChem CID 64765062) has the molecular formula C13H12FN3OS and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-fluoro-2-[(3-methyl-6-oxopyridazin-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-2-[(3-methyl-6-oxopyridazin-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 64765062 |
| Molecular Formula | C13H12FN3OS |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-fluoro-2-[(3-methyl-6-oxopyridazin-1-yl)methyl]benzenecarbothioamide |
| SMILES | Cc1ccc(=O)n(Cc2cc(F)ccc2C(N)=S)n1 |
| InChI | InChI=1S/C13H12FN3OS/c1-8-2-5-12(18)17(16-8)7-9-6-10(14)3-4-11(9)13(15)19/h2-6H,7H2,1H3,(H2,15,19) |
| InChIKey | SKMWEQVJIMLQFV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|