C18H13Cl2NO2 — CID 11617163
(E)-3-[3-[(2,4-dichlorophenyl)methyl]-2H-isoindol-1-yl]prop-2-enoic acid (PubChem CID 11617163) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (E)-3-[3-[(2,4-dichlorophenyl)methyl]-2H-isoindol-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(2,4-dichlorophenyl)methyl]-2H-isoindol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11617163 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (E)-3-[3-[(2,4-dichlorophenyl)methyl]-2H-isoindol-1-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1[nH]c(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-12-6-5-11(15(20)10-12)9-17-14-4-2-1-3-13(14)16(21-17)7-8-18(22)23/h1-8,10,21H,9H2,(H,22,23)/b8-7+ |
| InChIKey | PJBXLDAKDSXWCT-BQYQJAHWSA-N |
| XLogP | 5.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|