C18H11Cl2F3N2O2 — CID 142719645
(E)-3-[4-[(2,4-dichlorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]prop-2-enoic acid (PubChem CID 142719645) has the molecular formula C18H11Cl2F3N2O2 and a molecular weight of 415.20 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-dichlorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,4-dichlorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 142719645 |
| Molecular Formula | C18H11Cl2F3N2O2 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | (E)-3-[4-[(2,4-dichlorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nn(C(F)(F)F)c2cccc(Cc3ccc(Cl)cc3Cl)c12 |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c19-12-5-4-10(13(20)9-12)8-11-2-1-3-15-17(11)14(6-7-16(26)27)24-25(15)18(21,22)23/h1-7,9H,8H2,(H,26,27)/b7-6+ |
| InChIKey | BWXBZBHHUMTKCK-VOTSOKGWSA-N |
| XLogP | 5.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|