C19H13F5N2O2 — CID 142719622
(E)-3-[4-[(2,4-difluorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]-2-methylprop-2-enoic acid (PubChem CID 142719622) has the molecular formula C19H13F5N2O2 and a molecular weight of 396.32 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-difluorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[(2,4-difluorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 142719622 |
| Molecular Formula | C19H13F5N2O2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (E)-3-[4-[(2,4-difluorophenyl)methyl]-1-(trifluoromethyl)indazol-3-yl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1nn(C(F)(F)F)c2cccc(Cc3ccc(F)cc3F)c12)C(=O)O |
| InChI | InChI=1S/C19H13F5N2O2/c1-10(18(27)28)7-15-17-12(8-11-5-6-13(20)9-14(11)21)3-2-4-16(17)26(25-15)19(22,23)24/h2-7,9H,8H2,1H3,(H,27,28)/b10-7+ |
| InChIKey | MXAYLXTYJDPWIC-JXMROGBWSA-N |
| XLogP | 4.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|