C19H15F2NO3 — CID 170873356
(E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]-2-methylprop-2-enoic acid (PubChem CID 170873356) has the molecular formula C19H15F2NO3 and a molecular weight of 343.33 g/mol. Its IUPAC name is (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873356 |
| Molecular Formula | C19H15F2NO3 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(Oc2ccc(F)cc2F)n(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H15F2NO3/c1-11(19(23)24)9-14-13-5-3-4-6-16(13)22(2)18(14)25-17-8-7-12(20)10-15(17)21/h3-10H,1-2H3,(H,23,24)/b11-9+ |
| InChIKey | GUNDCXMVUPDIBB-PKNBQFBNSA-N |
| XLogP | 4.74 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|