C16H13F2NO2 — CID 170871680
[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]methanol (PubChem CID 170871680) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is [2-(2,4-difluorophenoxy)-1-methylindol-3-yl]methanol.
| Compound Name | [2-(2,4-difluorophenoxy)-1-methylindol-3-yl]methanol |
|---|---|
| PubChem CID | 170871680 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [2-(2,4-difluorophenoxy)-1-methylindol-3-yl]methanol |
| SMILES | Cn1c(Oc2ccc(F)cc2F)c(CO)c2ccccc21 |
| InChI | InChI=1S/C16H13F2NO2/c1-19-14-5-3-2-4-11(14)12(9-20)16(19)21-15-7-6-10(17)8-13(15)18/h2-8,20H,9H2,1H3 |
| InChIKey | VAHNMKDJHHEHIU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |