C18H13F2NO3 — CID 170872297
(E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]prop-2-enoic acid (PubChem CID 170872297) has the molecular formula C18H13F2NO3 and a molecular weight of 329.30 g/mol. Its IUPAC name is (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170872297 |
| Molecular Formula | C18H13F2NO3 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (E)-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]prop-2-enoic acid |
| SMILES | Cn1c(Oc2ccc(F)cc2F)c(/C=C/C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C18H13F2NO3/c1-21-15-5-3-2-4-12(15)13(7-9-17(22)23)18(21)24-16-8-6-11(19)10-14(16)20/h2-10H,1H3,(H,22,23)/b9-7+ |
| InChIKey | JERGCZSMQOAQHU-VQHVLOKHSA-N |
| XLogP | 4.35 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|