C19H18F2N2O3 — CID 170883448
methyl 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propanoate (PubChem CID 170883448) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is methyl 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propanoate.
| Compound Name | methyl 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 170883448 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propanoate |
| SMILES | COC(=O)C(N)Cc1c(Oc2ccc(F)cc2F)n(C)c2ccccc12 |
| InChI | InChI=1S/C19H18F2N2O3/c1-23-16-6-4-3-5-12(16)13(10-15(22)19(24)25-2)18(23)26-17-8-7-11(20)9-14(17)21/h3-9,15H,10,22H2,1-2H3 |
| InChIKey | CHDYQPYPQGCUMH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |