C18H18F2N2O2 — CID 170892609
2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propan-1-ol (PubChem CID 170892609) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propan-1-ol.
| Compound Name | 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 170892609 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-amino-3-[2-(2,4-difluorophenoxy)-1-methylindol-3-yl]propan-1-ol |
| SMILES | Cn1c(Oc2ccc(F)cc2F)c(CC(N)CO)c2ccccc21 |
| InChI | InChI=1S/C18H18F2N2O2/c1-22-16-5-3-2-4-13(16)14(9-12(21)10-23)18(22)24-17-7-6-11(19)8-15(17)20/h2-8,12,23H,9-10,21H2,1H3 |
| InChIKey | OTPPPMLQOSQFBA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |