C12H9F2NO2 — CID 61256286
[2-(2,4-difluorophenoxy)-3-pyridinyl]methanol (PubChem CID 61256286) has the molecular formula C12H9F2NO2 and a molecular weight of 237.21 g/mol. Its IUPAC name is [2-(2,4-difluorophenoxy)-3-pyridinyl]methanol.
| Compound Name | [2-(2,4-difluorophenoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 61256286 |
| Molecular Formula | C12H9F2NO2 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | [2-(2,4-difluorophenoxy)-3-pyridinyl]methanol |
| SMILES | OCc1cccnc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C12H9F2NO2/c13-9-3-4-11(10(14)6-9)17-12-8(7-16)2-1-5-15-12/h1-6,16H,7H2 |
| InChIKey | XOCANRIDCJGRKP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |