C18H21F2NO — CID 59545722
2-(2,4-difluorophenoxy)-3-heptylpyridine (PubChem CID 59545722) has the molecular formula C18H21F2NO and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-3-heptylpyridine.
| Compound Name | 2-(2,4-difluorophenoxy)-3-heptylpyridine |
|---|---|
| PubChem CID | 59545722 |
| Molecular Formula | C18H21F2NO |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-3-heptylpyridine |
| SMILES | CCCCCCCc1cccnc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C18H21F2NO/c1-2-3-4-5-6-8-14-9-7-12-21-18(14)22-17-11-10-15(19)13-16(17)20/h7,9-13H,2-6,8H2,1H3 |
| InChIKey | OVYWFEHRUFCHNP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|