C18H20F2N2O2 — CID 95190027
(3R)-N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]-3-methylpentanamide (PubChem CID 95190027) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is (3R)-N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]-3-methylpentanamide.
| Compound Name | (3R)-N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 95190027 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3R)-N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]-3-methylpentanamide |
| SMILES | CC[C@@H](C)CC(=O)NCc1cccnc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C18H20F2N2O2/c1-3-12(2)9-17(23)22-11-13-5-4-8-21-18(13)24-16-7-6-14(19)10-15(16)20/h4-8,10,12H,3,9,11H2,1-2H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | GQKHGMDQIHYDTD-GFCCVEGCSA-N |
| XLogP | 4.20 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |