C17H13F2N3O3S — CID 26407651
N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]pyridine-3-sulfonamide (PubChem CID 26407651) has the molecular formula C17H13F2N3O3S and a molecular weight of 377.37 g/mol. Its IUPAC name is N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]pyridine-3-sulfonamide.
| Compound Name | N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 26407651 |
| Molecular Formula | C17H13F2N3O3S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | N-[[2-(2,4-difluorophenoxy)-3-pyridinyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1cccnc1Oc1ccc(F)cc1F)c1cccnc1 |
| InChI | InChI=1S/C17H13F2N3O3S/c18-13-5-6-16(15(19)9-13)25-17-12(3-1-8-21-17)10-22-26(23,24)14-4-2-7-20-11-14/h1-9,11,22H,10H2 |
| InChIKey | SEDBBDWSCONDPD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |