C23H18F2N2O4S — CID 146525100
N-[4-(2,4-difluorophenoxy)-3-(4-oxoquinolin-1-yl)phenyl]ethanesulfonamide (PubChem CID 146525100) has the molecular formula C23H18F2N2O4S and a molecular weight of 456.47 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(4-oxoquinolin-1-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(4-oxoquinolin-1-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 146525100 |
| Molecular Formula | C23H18F2N2O4S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(4-oxoquinolin-1-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-n2ccc(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C23H18F2N2O4S/c1-2-32(29,30)26-16-8-10-23(31-22-9-7-15(24)13-18(22)25)20(14-16)27-12-11-21(28)17-5-3-4-6-19(17)27/h3-14,26H,2H2,1H3 |
| InChIKey | CZBNVRRDCBLVJV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |