C22H18F2N2O4S — CID 118024917
N-[4-(2,4-difluorophenoxy)-3-(5-ethynyl-2-methyl-6-oxo-1H-pyridin-3-yl)phenyl]ethanesulfonamide (PubChem CID 118024917) has the molecular formula C22H18F2N2O4S and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(5-ethynyl-2-methyl-6-oxo-1H-pyridin-3-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(5-ethynyl-2-methyl-6-oxo-1H-pyridin-3-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 118024917 |
| Molecular Formula | C22H18F2N2O4S |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(5-ethynyl-2-methyl-6-oxo-1H-pyridin-3-yl)phenyl]ethanesulfonamide |
| SMILES | C#Cc1cc(-c2cc(NS(=O)(=O)CC)ccc2Oc2ccc(F)cc2F)c(C)[nH]c1=O |
| InChI | InChI=1S/C22H18F2N2O4S/c1-4-14-10-17(13(3)25-22(14)27)18-12-16(26-31(28,29)5-2)7-9-20(18)30-21-8-6-15(23)11-19(21)24/h1,6-12,26H,5H2,2-3H3,(H,25,27) |
| InChIKey | XLWHSNRWCCXIFW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|