C21H20F2N2O5S — CID 163214157
N-[4-(2,4-difluorophenoxy)-3-(2-methoxy-6-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]ethanesulfonamide (PubChem CID 163214157) has the molecular formula C21H20F2N2O5S and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(2-methoxy-6-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(2-methoxy-6-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 163214157 |
| Molecular Formula | C21H20F2N2O5S |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(2-methoxy-6-methyl-1-oxidopyridin-1-ium-4-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cc(C)[n+]([O-])c(OC)c2)c1 |
| InChI | InChI=1S/C21H20F2N2O5S/c1-4-31(27,28)24-16-6-8-19(30-20-7-5-15(22)11-18(20)23)17(12-16)14-9-13(2)25(26)21(10-14)29-3/h5-12,24H,4H2,1-3H3 |
| InChIKey | SOEAAKCHYFMCKC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|