C22H19F5N2O5S — CID 163214156
N-[4-(2,4-difluorophenoxy)-3-[2-methyl-1-oxido-6-(2,2,2-trifluoroethoxy)pyridin-1-ium-4-yl]phenyl]ethanesulfonamide (PubChem CID 163214156) has the molecular formula C22H19F5N2O5S and a molecular weight of 518.46 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-[2-methyl-1-oxido-6-(2,2,2-trifluoroethoxy)pyridin-1-ium-4-yl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-[2-methyl-1-oxido-6-(2,2,2-trifluoroethoxy)pyridin-1-ium-4-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 163214156 |
| Molecular Formula | C22H19F5N2O5S |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-[2-methyl-1-oxido-6-(2,2,2-trifluoroethoxy)pyridin-1-ium-4-yl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cc(C)[n+]([O-])c(OCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H19F5N2O5S/c1-3-35(31,32)28-16-5-7-19(34-20-6-4-15(23)10-18(20)24)17(11-16)14-8-13(2)29(30)21(9-14)33-12-22(25,26)27/h4-11,28H,3,12H2,1-2H3 |
| InChIKey | WTSZVYWJQPUELE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|