C33H27F2N3O3S — CID 175219554
N-[3-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide (PubChem CID 175219554) has the molecular formula C33H27F2N3O3S and a molecular weight of 583.66 g/mol. Its IUPAC name is N-[3-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide.
| Compound Name | N-[3-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 175219554 |
| Molecular Formula | C33H27F2N3O3S |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | N-[3-[2-(benzhydrylideneamino)-6-methyl-4-pyridinyl]-4-(2,4-difluorophenoxy)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cc(C)nc(N=C(c3ccccc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C33H27F2N3O3S/c1-3-42(39,40)38-27-15-17-30(41-31-16-14-26(34)20-29(31)35)28(21-27)25-18-22(2)36-32(19-25)37-33(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-21,38H,3H2,1-2H3 |
| InChIKey | QOKYGTRZTOMEHI-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|