C21H21F2N3O4S — CID 163214150
N-[4-(2,4-difluorophenoxy)-3-(1-hydroxy-2-methyl-6-methylimino-4-pyridinyl)phenyl]ethanesulfonamide (PubChem CID 163214150) has the molecular formula C21H21F2N3O4S and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(1-hydroxy-2-methyl-6-methylimino-4-pyridinyl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(1-hydroxy-2-methyl-6-methylimino-4-pyridinyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 163214150 |
| Molecular Formula | C21H21F2N3O4S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(1-hydroxy-2-methyl-6-methylimino-4-pyridinyl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cc(C)n(O)/c(=N\C)c2)c1 |
| InChI | InChI=1S/C21H21F2N3O4S/c1-4-31(28,29)25-16-6-8-19(30-20-7-5-15(22)11-18(20)23)17(12-16)14-9-13(2)26(27)21(10-14)24-3/h5-12,25,27H,4H2,1-3H3/b24-21- |
| InChIKey | OGBOOEQNKMHWJD-FLFQWRMESA-N |
| XLogP | 4.06 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|