C30H29F2N5O5S — CID 134516422
N-[4-(2,4-difluorophenoxy)-3-[8-[(2,4-dimethoxyphenyl)methylamino]-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]ethanesulfonamide (PubChem CID 134516422) has the molecular formula C30H29F2N5O5S and a molecular weight of 609.66 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-[8-[(2,4-dimethoxyphenyl)methylamino]-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]ethanesulfonamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-[8-[(2,4-dimethoxyphenyl)methylamino]-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 134516422 |
| Molecular Formula | C30H29F2N5O5S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-[8-[(2,4-dimethoxyphenyl)methylamino]-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cc(NCc3ccc(OC)cc3OC)c3nnc(C)n3c2)c1 |
| InChI | InChI=1S/C30H29F2N5O5S/c1-5-43(38,39)36-22-8-11-27(42-28-10-7-21(31)13-25(28)32)24(14-22)20-12-26(30-35-34-18(2)37(30)17-20)33-16-19-6-9-23(40-3)15-29(19)41-4/h6-15,17,33,36H,5,16H2,1-4H3 |
| InChIKey | QXMZOBNKQYYEIY-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |