C19H13F3N4O — CID 134516562
4-(2,4-difluorophenoxy)-3-(8-fluoro-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)aniline (PubChem CID 134516562) has the molecular formula C19H13F3N4O and a molecular weight of 370.33 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-3-(8-fluoro-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)aniline.
| Compound Name | 4-(2,4-difluorophenoxy)-3-(8-fluoro-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)aniline |
|---|---|
| PubChem CID | 134516562 |
| Molecular Formula | C19H13F3N4O |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-3-(8-fluoro-3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)aniline |
| SMILES | Cc1nnc2c(F)cc(-c3cc(N)ccc3Oc3ccc(F)cc3F)cn12 |
| InChI | InChI=1S/C19H13F3N4O/c1-10-24-25-19-16(22)6-11(9-26(10)19)14-8-13(23)3-5-17(14)27-18-4-2-12(20)7-15(18)21/h2-9H,23H2,1H3 |
| InChIKey | ADAPZICNMKRVSI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|