C20H19F2N3O2 — CID 146524986
5-[5-amino-2-(2,4-difluorophenoxy)phenyl]-3-(dimethylamino)-1-methylpyridin-2-one (PubChem CID 146524986) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 5-[5-amino-2-(2,4-difluorophenoxy)phenyl]-3-(dimethylamino)-1-methylpyridin-2-one.
| Compound Name | 5-[5-amino-2-(2,4-difluorophenoxy)phenyl]-3-(dimethylamino)-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 146524986 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 5-[5-amino-2-(2,4-difluorophenoxy)phenyl]-3-(dimethylamino)-1-methylpyridin-2-one |
| SMILES | CN(C)c1cc(-c2cc(N)ccc2Oc2ccc(F)cc2F)cn(C)c1=O |
| InChI | InChI=1S/C20H19F2N3O2/c1-24(2)17-8-12(11-25(3)20(17)26)15-10-14(23)5-7-18(15)27-19-6-4-13(21)9-16(19)22/h4-11H,23H2,1-3H3 |
| InChIKey | CAWBIMZBHDADKX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|