C20H16F3N2O4S- — CID 134495337
5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-3-fluoro-1-methyl-2-oxopyridine (PubChem CID 134495337) has the molecular formula C20H16F3N2O4S- and a molecular weight of 437.42 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-3-fluoro-1-methyl-2-oxopyridine.
| Compound Name | 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-3-fluoro-1-methyl-2-oxopyridine |
|---|---|
| PubChem CID | 134495337 |
| Molecular Formula | C20H16F3N2O4S- |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-3-fluoro-1-methyl-2-oxopyridine |
| SMILES | Cn1cc(-c2cc(CCNS(=O)[O-])ccc2Oc2ccc(F)cc2F)cc(F)c1=O |
| InChI | InChI=1S/C20H17F3N2O4S/c1-25-11-13(9-17(23)20(25)26)15-8-12(6-7-24-30(27)28)2-4-18(15)29-19-5-3-14(21)10-16(19)22/h2-5,8-11,24H,6-7H2,1H3,(H,27,28)/p-1 |
| InChIKey | ZIMGWZZOIFULAL-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|