C22H22ClN2O5S- — CID 134495327
5-[2-(4-chlorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine (PubChem CID 134495327) has the molecular formula C22H22ClN2O5S- and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-[2-(4-chlorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine.
| Compound Name | 5-[2-(4-chlorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
|---|---|
| PubChem CID | 134495327 |
| Molecular Formula | C22H22ClN2O5S- |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 5-[2-(4-chlorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
| SMILES | CCOc1cc(=O)n(C)cc1-c1cc(CCNS(=O)[O-])ccc1Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN2O5S/c1-3-29-21-13-22(26)25(2)14-19(21)18-12-15(10-11-24-31(27)28)4-9-20(18)30-17-7-5-16(23)6-8-17/h4-9,12-14,24H,3,10-11H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | HIEQIXQWYBOAKM-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|