C25H20F2N2O5S2 — CID 134495297
5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinoamino)ethyl]phenyl]-4-(4-formylthiophen-3-yl)-1-methyl-2-oxopyridine (PubChem CID 134495297) has the molecular formula C25H20F2N2O5S2 and a molecular weight of 530.57 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinoamino)ethyl]phenyl]-4-(4-formylthiophen-3-yl)-1-methyl-2-oxopyridine.
| Compound Name | 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinoamino)ethyl]phenyl]-4-(4-formylthiophen-3-yl)-1-methyl-2-oxopyridine |
|---|---|
| PubChem CID | 134495297 |
| Molecular Formula | C25H20F2N2O5S2 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | 5-[2-(2,4-difluorophenoxy)-5-[2-(sulfinoamino)ethyl]phenyl]-4-(4-formylthiophen-3-yl)-1-methyl-2-oxopyridine |
| SMILES | Cn1cc(-c2cc(CCNS(=O)O)ccc2Oc2ccc(F)cc2F)c(-c2cscc2C=O)cc1=O |
| InChI | InChI=1S/C25H20F2N2O5S2/c1-29-11-20(18(10-25(29)31)21-14-35-13-16(21)12-30)19-8-15(6-7-28-36(32)33)2-4-23(19)34-24-5-3-17(26)9-22(24)27/h2-5,8-14,28H,6-7H2,1H3,(H,32,33) |
| InChIKey | PODDAISRSVZWFG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|