C23H21FN3O5S- — CID 134495321
5-[2-(4-cyano-2-fluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine (PubChem CID 134495321) has the molecular formula C23H21FN3O5S- and a molecular weight of 470.50 g/mol. Its IUPAC name is 5-[2-(4-cyano-2-fluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine.
| Compound Name | 5-[2-(4-cyano-2-fluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
|---|---|
| PubChem CID | 134495321 |
| Molecular Formula | C23H21FN3O5S- |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 5-[2-(4-cyano-2-fluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
| SMILES | CCOc1cc(=O)n(C)cc1-c1cc(CCNS(=O)[O-])ccc1Oc1ccc(C#N)cc1F |
| InChI | InChI=1S/C23H22FN3O5S/c1-3-31-22-12-23(28)27(2)14-18(22)17-10-15(8-9-26-33(29)30)4-6-20(17)32-21-7-5-16(13-25)11-19(21)24/h4-7,10-12,14,26H,3,8-9H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | QWNUIZBIHIVMBK-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|