C22H20ClF2N2O5S- — CID 134495348
5-[2-(4-chloro-2,6-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine (PubChem CID 134495348) has the molecular formula C22H20ClF2N2O5S- and a molecular weight of 497.93 g/mol. Its IUPAC name is 5-[2-(4-chloro-2,6-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine.
| Compound Name | 5-[2-(4-chloro-2,6-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
|---|---|
| PubChem CID | 134495348 |
| Molecular Formula | C22H20ClF2N2O5S- |
| Molecular Weight | 497.93 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 5-[2-(4-chloro-2,6-difluorophenoxy)-5-[2-(sulfinatoamino)ethyl]phenyl]-4-ethoxy-1-methyl-2-oxopyridine |
| SMILES | CCOc1cc(=O)n(C)cc1-c1cc(CCNS(=O)[O-])ccc1Oc1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C22H21ClF2N2O5S/c1-3-31-20-11-21(28)27(2)12-16(20)15-8-13(6-7-26-33(29)30)4-5-19(15)32-22-17(24)9-14(23)10-18(22)25/h4-5,8-12,26H,3,6-7H2,1-2H3,(H,29,30)/p-1 |
| InChIKey | FSAYIYICQUBCHS-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.93 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|