C20H16F2N6O3 — CID 134516299
ethyl N-[6-[5-amino-2-(2,4-difluorophenoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate (PubChem CID 134516299) has the molecular formula C20H16F2N6O3 and a molecular weight of 426.38 g/mol. Its IUPAC name is ethyl N-[6-[5-amino-2-(2,4-difluorophenoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate.
| Compound Name | ethyl N-[6-[5-amino-2-(2,4-difluorophenoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate |
|---|---|
| PubChem CID | 134516299 |
| Molecular Formula | C20H16F2N6O3 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | ethyl N-[6-[5-amino-2-(2,4-difluorophenoxy)phenyl]-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc(-c2cc(N)ccc2Oc2ccc(F)cc2F)nn2cnnc12 |
| InChI | InChI=1S/C20H16F2N6O3/c1-2-30-20(29)25-16-9-15(27-28-10-24-26-19(16)28)13-8-12(23)4-6-17(13)31-18-5-3-11(21)7-14(18)22/h3-10H,2,23H2,1H3,(H,25,29) |
| InChIKey | WUFOZTYDJBFKEH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|