C21H18F2N4O3 — CID 146575622
N-[3-(2,4-difluorophenoxy)-2-[1-methyl-5-(methylamino)-6-oxopyridazin-3-yl]phenyl]prop-2-enamide (PubChem CID 146575622) has the molecular formula C21H18F2N4O3 and a molecular weight of 412.40 g/mol. Its IUPAC name is N-[3-(2,4-difluorophenoxy)-2-[1-methyl-5-(methylamino)-6-oxopyridazin-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-(2,4-difluorophenoxy)-2-[1-methyl-5-(methylamino)-6-oxopyridazin-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146575622 |
| Molecular Formula | C21H18F2N4O3 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[3-(2,4-difluorophenoxy)-2-[1-methyl-5-(methylamino)-6-oxopyridazin-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2ccc(F)cc2F)c1-c1cc(NC)c(=O)n(C)n1 |
| InChI | InChI=1S/C21H18F2N4O3/c1-4-19(28)25-14-6-5-7-18(30-17-9-8-12(22)10-13(17)23)20(14)15-11-16(24-2)21(29)27(3)26-15/h4-11,24H,1H2,2-3H3,(H,25,28) |
| InChIKey | NQYRRAXVFJHOAR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|