C23H17F2N3O5 — CID 146525026
N-[4-(2,4-difluorophenoxy)-3-(6-methyl-3,5-dioxo-4H-pyrido[4,3-b][1,4]oxazin-8-yl)phenyl]prop-2-enamide (PubChem CID 146525026) has the molecular formula C23H17F2N3O5 and a molecular weight of 453.40 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)-3-(6-methyl-3,5-dioxo-4H-pyrido[4,3-b][1,4]oxazin-8-yl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)-3-(6-methyl-3,5-dioxo-4H-pyrido[4,3-b][1,4]oxazin-8-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146525026 |
| Molecular Formula | C23H17F2N3O5 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)-3-(6-methyl-3,5-dioxo-4H-pyrido[4,3-b][1,4]oxazin-8-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3c2OCC(=O)N3)c1 |
| InChI | InChI=1S/C23H17F2N3O5/c1-3-19(29)26-13-5-7-17(33-18-6-4-12(24)8-16(18)25)14(9-13)15-10-28(2)23(31)21-22(15)32-11-20(30)27-21/h3-10H,1,11H2,2H3,(H,26,29)(H,27,30) |
| InChIKey | KWQDMXJTZVJZKJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|