C22H20FN3O3 — CID 146524990
N-[4-(4-fluorophenoxy)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide (PubChem CID 146524990) has the molecular formula C22H20FN3O3 and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-fluorophenoxy)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146524990 |
| Molecular Formula | C22H20FN3O3 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[4-(4-fluorophenoxy)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Oc2ccc(F)cc2)c(-c2cc(NC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C22H20FN3O3/c1-4-21(27)25-16-7-10-20(29-17-8-5-15(23)6-9-17)18(12-16)14-11-19(24-2)22(28)26(3)13-14/h4-13,24H,1H2,2-3H3,(H,25,27) |
| InChIKey | OPRMILVNGWHKTJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|