C28H29FN2O4 — CID 163934488
N-[4-(2-fluoro-4-methylphenoxy)-3-[1-methyl-5-(4-methyl-2-oxopentyl)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide (PubChem CID 163934488) has the molecular formula C28H29FN2O4 and a molecular weight of 476.55 g/mol. Its IUPAC name is N-[4-(2-fluoro-4-methylphenoxy)-3-[1-methyl-5-(4-methyl-2-oxopentyl)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(2-fluoro-4-methylphenoxy)-3-[1-methyl-5-(4-methyl-2-oxopentyl)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163934488 |
| Molecular Formula | C28H29FN2O4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-[4-(2-fluoro-4-methylphenoxy)-3-[1-methyl-5-(4-methyl-2-oxopentyl)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Oc2ccc(C)cc2F)c(-c2cc(CC(=O)CC(C)C)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C28H29FN2O4/c1-6-27(33)30-21-8-10-25(35-26-9-7-18(4)12-24(26)29)23(15-21)20-13-19(28(34)31(5)16-20)14-22(32)11-17(2)3/h6-10,12-13,15-17H,1,11,14H2,2-5H3,(H,30,33) |
| InChIKey | NPIQNHGUMCKWEL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|