C25H22FN3O3 — CID 163756529
2-cyano-N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(2-fluoro-4-methylphenoxy)phenyl]prop-2-enamide (PubChem CID 163756529) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-cyano-N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(2-fluoro-4-methylphenoxy)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(2-fluoro-4-methylphenoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 163756529 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-cyano-N-[3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)-4-(2-fluoro-4-methylphenoxy)phenyl]prop-2-enamide |
| SMILES | C=C(C#N)C(=O)Nc1ccc(Oc2ccc(C)cc2F)c(-c2cc(CC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C25H22FN3O3/c1-5-17-11-18(14-29(4)25(17)31)20-12-19(28-24(30)16(3)13-27)7-9-22(20)32-23-8-6-15(2)10-21(23)26/h6-12,14H,3,5H2,1-2,4H3,(H,28,30) |
| InChIKey | ATHKPFQBWHTXDJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|