C25H22F2N2O2 — CID 161013266
N-[4-[(2,4-difluorophenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]but-2-ynamide (PubChem CID 161013266) has the molecular formula C25H22F2N2O2 and a molecular weight of 420.46 g/mol. Its IUPAC name is N-[4-[(2,4-difluorophenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]but-2-ynamide.
| Compound Name | N-[4-[(2,4-difluorophenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 161013266 |
| Molecular Formula | C25H22F2N2O2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-[4-[(2,4-difluorophenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1ccc(Cc2ccc(F)cc2F)c(-c2cc(CC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C25H22F2N2O2/c1-4-6-24(30)28-21-10-8-17(12-18-7-9-20(26)13-23(18)27)22(14-21)19-11-16(5-2)25(31)29(3)15-19/h7-11,13-15H,5,12H2,1-3H3,(H,28,30) |
| InChIKey | TXJUTMBTNDQYGD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|