C26H26N2O2 — CID 161445844
N-[4-[(2,6-dimethylphenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]prop-2-ynamide (PubChem CID 161445844) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylphenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]prop-2-ynamide.
| Compound Name | N-[4-[(2,6-dimethylphenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 161445844 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[4-[(2,6-dimethylphenyl)methyl]-3-(5-ethyl-1-methyl-6-oxo-3-pyridinyl)phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)Nc1ccc(Cc2c(C)cccc2C)c(-c2cc(CC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C26H26N2O2/c1-6-19-13-21(16-28(5)26(19)30)24-15-22(27-25(29)7-2)12-11-20(24)14-23-17(3)9-8-10-18(23)4/h2,8-13,15-16H,6,14H2,1,3-5H3,(H,27,29) |
| InChIKey | VZWMLIYSOJGGJD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|