C24H24N4O2 — CID 146575656
N-[4-(2,6-dimethylanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-ynamide (PubChem CID 146575656) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[4-(2,6-dimethylanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-ynamide.
| Compound Name | N-[4-(2,6-dimethylanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 146575656 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | N-[4-(2,6-dimethylanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)Nc1ccc(Nc2c(C)cccc2C)c(-c2cc(NC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C24H24N4O2/c1-6-22(29)26-18-10-11-20(27-23-15(2)8-7-9-16(23)3)19(13-18)17-12-21(25-4)24(30)28(5)14-17/h1,7-14,25,27H,2-5H3,(H,26,29) |
| InChIKey | DEXRELVFLSAJCE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|