C27H24FN3O2 — CID 146574258
N-[4-(4-fluoro-2,6-dimethylanilino)-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]prop-2-enamide (PubChem CID 146574258) has the molecular formula C27H24FN3O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is N-[4-(4-fluoro-2,6-dimethylanilino)-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-fluoro-2,6-dimethylanilino)-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146574258 |
| Molecular Formula | C27H24FN3O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[4-(4-fluoro-2,6-dimethylanilino)-3-(2-methyl-1-oxoisoquinolin-4-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Nc2c(C)cc(F)cc2C)c(-c2cn(C)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C27H24FN3O2/c1-5-25(32)29-19-10-11-24(30-26-16(2)12-18(28)13-17(26)3)22(14-19)23-15-31(4)27(33)21-9-7-6-8-20(21)23/h5-15,30H,1H2,2-4H3,(H,29,32) |
| InChIKey | ZAKWSSWGEHLDGD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|