About 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one
4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one (PubChem CID 146576624) has the molecular formula C25H18F2N2O2
and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one.
Molecular Properties
| Compound Name | 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one |
| PubChem CID | 146576624 |
| Molecular Formula | C25H18F2N2O2 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one |
| SMILES | C=CC(=O)c1ccc(Nc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C25H18F2N2O2/c1-3-24(30)15-8-10-22(28-23-11-9-16(26)13-21(23)27)19(12-15)20-14-29(2)25(31)18-7-5-4-6-17(18)20/h3-14,28H,1H2,2H3 |
| InChIKey | VQHAXPJNWYLEFJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one?
The IUPAC name of 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one (CID 146576624) is 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one.
What is the SMILES notation for 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one?
The canonical SMILES for 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one is C=CC(=O)c1ccc(Nc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3ccccc23)c1.
What is the InChIKey of 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one?
The InChIKey is VQHAXPJNWYLEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18F2N2O2/c1-3-24(30)15-8-10-22(28-23-11-9-16(26)13-21(23)27)19(12-15)20-14-29(2)25(31)18-7-5-4-6-17(18)20/h3-14,28H,1H2,2H3.
What are the key properties of 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one?
4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one has a molecular weight of 416.43 g/mol, XLogP of 5.60, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-difluoroanilino)-5-prop-2-enoylphenyl]-2-methylisoquinolin-1-one is sourced from PubChem (CID 146576624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).